C14H27N2S+ — CID 24869576
2-(1-ethylpiperidin-1-ium-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole (PubChem CID 24869576) has the molecular formula C14H27N2S+ and a molecular weight of 255.45 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-1-ium-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole.
| Compound Name | 2-(1-ethylpiperidin-1-ium-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 24869576 |
| Molecular Formula | C14H27N2S+ |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 2-(1-ethylpiperidin-1-ium-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole |
| SMILES | CC[NH+]1CCCC(C2NC3CCCCC3S2)C1 |
| InChI | InChI=1S/C14H26N2S/c1-2-16-9-5-6-11(10-16)14-15-12-7-3-4-8-13(12)17-14/h11-15H,2-10H2,1H3/p+1 |
| InChIKey | QQUYLTAXWNZYKT-UHFFFAOYSA-O |
| XLogP | 1.27 |
| TPSA | 16.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |