C15H28N2OS — CID 140689804
4-(2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-ylmethoxy)-2-methylcyclohexan-1-amine (PubChem CID 140689804) has the molecular formula C15H28N2OS and a molecular weight of 284.47 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-ylmethoxy)-2-methylcyclohexan-1-amine.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-ylmethoxy)-2-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 140689804 |
| Molecular Formula | C15H28N2OS |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-ylmethoxy)-2-methylcyclohexan-1-amine |
| SMILES | CC1CC(OCC2NC3CCCCC3S2)CCC1N |
| InChI | InChI=1S/C15H28N2OS/c1-10-8-11(6-7-12(10)16)18-9-15-17-13-4-2-3-5-14(13)19-15/h10-15,17H,2-9,16H2,1H3 |
| InChIKey | CYIPMXYCAHGALL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |