C6H8S4 — CID 139938320
2,4-bis(thiiran-2-yl)-1,3-dithietane (PubChem CID 139938320) has the molecular formula C6H8S4 and a molecular weight of 208.40 g/mol. Its IUPAC name is 2,4-bis(thiiran-2-yl)-1,3-dithietane.
| Compound Name | 2,4-bis(thiiran-2-yl)-1,3-dithietane |
|---|---|
| PubChem CID | 139938320 |
| Molecular Formula | C6H8S4 |
| Molecular Weight | 208.40 g/mol |
| Exact Mass | 207.95 |
| IUPAC Name | 2,4-bis(thiiran-2-yl)-1,3-dithietane |
| SMILES | C1SC1C1SC(C2CS2)S1 |
| InChI | InChI=1S/C6H8S4/c1-3(7-1)5-9-6(10-5)4-2-8-4/h3-6H,1-2H2 |
| InChIKey | ULDRMQCVEGMUDN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|