About 2-(thiiran-2-yl)oxirane
2-(thiiran-2-yl)oxirane (PubChem CID 154083597) has the molecular formula C4H6OS
and a molecular weight of 102.16 g/mol. Its IUPAC name is 2-(thiiran-2-yl)oxirane.
Molecular Properties
| Compound Name | 2-(thiiran-2-yl)oxirane |
| PubChem CID | 154083597 |
| Molecular Formula | C4H6OS |
| Molecular Weight | 102.16 g/mol |
| Exact Mass | 102.01 |
| IUPAC Name | 2-(thiiran-2-yl)oxirane |
| SMILES | C1OC1C1CS1 |
| InChI | InChI=1S/C4H6OS/c1-3(5-1)4-2-6-4/h3-4H,1-2H2 |
| InChIKey | MQDBSZMXPLOTRY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(thiiran-2-yl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thiiran-2-yl)oxirane?
The IUPAC name of 2-(thiiran-2-yl)oxirane (CID 154083597) is 2-(thiiran-2-yl)oxirane.
What is the SMILES notation for 2-(thiiran-2-yl)oxirane?
The canonical SMILES for 2-(thiiran-2-yl)oxirane is C1OC1C1CS1.
What is the InChIKey of 2-(thiiran-2-yl)oxirane?
The InChIKey is MQDBSZMXPLOTRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6OS/c1-3(5-1)4-2-6-4/h3-4H,1-2H2.
What are the key properties of 2-(thiiran-2-yl)oxirane?
2-(thiiran-2-yl)oxirane has a molecular weight of 102.16 g/mol, XLogP of 0.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thiiran-2-yl)oxirane is sourced from PubChem (CID 154083597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).