C18H26O6S3 — CID 101342011
5,7-bis(2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxine (PubChem CID 101342011) has the molecular formula C18H26O6S3 and a molecular weight of 434.60 g/mol. Its IUPAC name is 5,7-bis(2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5,7-bis(2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 101342011 |
| Molecular Formula | C18H26O6S3 |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 5,7-bis(2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxine |
| SMILES | C1COC2C(CSC2C2SC(C3SCC4OCCOC43)C3OCCOC32)O1 |
| InChI | InChI=1S/C18H26O6S3/c1-3-21-11-9(19-1)7-25-15(11)17-13-14(24-6-5-23-13)18(27-17)16-12-10(8-26-16)20-2-4-22-12/h9-18H,1-8H2 |
| InChIKey | KTZCLDXJWMILJR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |