About 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole
3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole (PubChem CID 67194939) has the molecular formula C7H12OS
and a molecular weight of 144.24 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole.
Analyze 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole?
The IUPAC name of 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole (CID 67194939) is 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole.
What is the SMILES notation for 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole?
The canonical SMILES for 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole is C1CCC2SCOC2C1.
What is the InChIKey of 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole?
The InChIKey is OFDDLSDBCWEDEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12OS/c1-2-4-7-6(3-1)8-5-9-7/h6-7H,1-5H2.
What are the key properties of 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole?
3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole has a molecular weight of 144.24 g/mol, XLogP of 2.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole is sourced from PubChem (CID 67194939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).