About 3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran
3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran (PubChem CID 118210349) has the molecular formula C7H12OS
and a molecular weight of 144.24 g/mol. Its IUPAC name is 3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran.
Analyze 3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran?
The IUPAC name of 3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran (CID 118210349) is 3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran.
What is the SMILES notation for 3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran?
The canonical SMILES for 3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran is C1COC2CCSC2C1.
What is the InChIKey of 3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran?
The InChIKey is ANJRBASVYZDNGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12OS/c1-2-7-6(8-4-1)3-5-9-7/h6-7H,1-5H2.
What are the key properties of 3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran?
3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran has a molecular weight of 144.24 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]pyran is sourced from PubChem (CID 118210349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).