About 3-(oxolan-2-yl)dioxolane
3-(oxolan-2-yl)dioxolane (PubChem CID 22111450) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-(oxolan-2-yl)dioxolane.
Molecular Properties
| Compound Name | 3-(oxolan-2-yl)dioxolane |
| PubChem CID | 22111450 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 3-(oxolan-2-yl)dioxolane |
| SMILES | C1COC(C2CCOO2)C1 |
| InChI | InChI=1S/C7H12O3/c1-2-6(8-4-1)7-3-5-9-10-7/h6-7H,1-5H2 |
| InChIKey | NHHVFVWSWJQOJV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-(oxolan-2-yl)dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxolan-2-yl)dioxolane?
The IUPAC name of 3-(oxolan-2-yl)dioxolane (CID 22111450) is 3-(oxolan-2-yl)dioxolane.
What is the SMILES notation for 3-(oxolan-2-yl)dioxolane?
The canonical SMILES for 3-(oxolan-2-yl)dioxolane is C1COC(C2CCOO2)C1.
What is the InChIKey of 3-(oxolan-2-yl)dioxolane?
The InChIKey is NHHVFVWSWJQOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-2-6(8-4-1)7-3-5-9-10-7/h6-7H,1-5H2.
What are the key properties of 3-(oxolan-2-yl)dioxolane?
3-(oxolan-2-yl)dioxolane has a molecular weight of 144.17 g/mol, XLogP of 0.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxolan-2-yl)dioxolane is sourced from PubChem (CID 22111450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).