C14H24O3 — CID 15321473
(1S,6E,13R)-2,11,14-trioxabicyclo[11.4.0]heptadec-6-ene (PubChem CID 15321473) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (1S,6E,13R)-2,11,14-trioxabicyclo[11.4.0]heptadec-6-ene.
| Compound Name | (1S,6E,13R)-2,11,14-trioxabicyclo[11.4.0]heptadec-6-ene |
|---|---|
| PubChem CID | 15321473 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (1S,6E,13R)-2,11,14-trioxabicyclo[11.4.0]heptadec-6-ene |
| SMILES | C1=C/CCCO[C@H]2CCCO[C@@H]2COCCC/1 |
| InChI | InChI=1S/C14H24O3/c1-2-4-6-10-16-13-8-7-11-17-14(13)12-15-9-5-3-1/h1-2,13-14H,3-12H2/b2-1+/t13-,14+/m0/s1 |
| InChIKey | BSILTHQSUMNGJS-OHVOQOPOSA-N |
| XLogP | 2.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|