C16H26O3 — CID 143765684
4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;ethane;toluene (PubChem CID 143765684) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;ethane;toluene.
| Compound Name | 4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;ethane;toluene |
|---|---|
| PubChem CID | 143765684 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;ethane;toluene |
| SMILES | C1COC2COCOC2C1.CC.Cc1ccccc1 |
| InChI | InChI=1S/C7H12O3.C7H8.C2H6/c1-2-6-7(9-3-1)4-8-5-10-6;1-7-5-3-2-4-6-7;1-2/h6-7H,1-5H2;2-6H,1H3;1-2H3 |
| InChIKey | JAGQOSUEXMULLM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |