About 4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran
4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 146474205) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is 4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
Analyze 4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran?
The IUPAC name of 4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (CID 146474205) is 4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
What is the SMILES notation for 4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran?
The canonical SMILES for 4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran is C1CC2OCOC2CO1.
What is the InChIKey of 4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran?
The InChIKey is FZWHRRMKNZLQGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-2-7-3-6-5(1)8-4-9-6/h5-6H,1-4H2.
What are the key properties of 4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran?
4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran has a molecular weight of 130.14 g/mol, XLogP of 0.15, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran is sourced from PubChem (CID 146474205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).