C6H10O2 — CID 83669972
3,8-dioxabicyclo[4.2.0]octane (PubChem CID 83669972) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is 3,8-dioxabicyclo[4.2.0]octane.
| Compound Name | 3,8-dioxabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 83669972 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 3,8-dioxabicyclo[4.2.0]octane |
| SMILES | C1CC2COC2CO1 |
| InChI | InChI=1S/C6H10O2/c1-2-7-4-6-5(1)3-8-6/h5-6H,1-4H2 |
| InChIKey | NXRFOWCLDYAHHU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |