C10H16O3 — CID 150634021
3-(1,4-dioxan-2-yl)-7-oxabicyclo[4.1.0]heptane (PubChem CID 150634021) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 3-(1,4-dioxan-2-yl)-7-oxabicyclo[4.1.0]heptane.
| Compound Name | 3-(1,4-dioxan-2-yl)-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 150634021 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 3-(1,4-dioxan-2-yl)-7-oxabicyclo[4.1.0]heptane |
| SMILES | C1COC(C2CCC3OC3C2)CO1 |
| InChI | InChI=1S/C10H16O3/c1-2-8-9(13-8)5-7(1)10-6-11-3-4-12-10/h7-10H,1-6H2 |
| InChIKey | IYMQDIOGHDKUQH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|