C5H8O2 — CID 118053300
2,7-dioxabicyclo[3.2.0]heptane (PubChem CID 118053300) has the molecular formula C5H8O2 and a molecular weight of 100.12 g/mol. Its IUPAC name is 2,7-dioxabicyclo[3.2.0]heptane.
| Compound Name | 2,7-dioxabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 118053300 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | 2,7-dioxabicyclo[3.2.0]heptane |
| SMILES | C1CC2COC2O1 |
| InChI | InChI=1S/C5H8O2/c1-2-6-5-4(1)3-7-5/h4-5H,1-3H2 |
| InChIKey | CMTGZLZAPGEEGO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |