C7H12O2 — CID 58779336
(4R,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan (PubChem CID 58779336) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is (4R,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan.
| Compound Name | (4R,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan |
|---|---|
| PubChem CID | 58779336 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (4R,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan |
| SMILES | C[C@H]1CO[C@H]2OCCC21 |
| InChI | InChI=1S/C7H12O2/c1-5-4-9-7-6(5)2-3-8-7/h5-7H,2-4H2,1H3/t5-,6?,7+/m0/s1 |
| InChIKey | OKGTUTLBTVDZPJ-REJBHVJUSA-N |
| XLogP | 1.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |