C9H18O2 — CID 144768068
(3aR,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;ethane (PubChem CID 144768068) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (3aR,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;ethane.
| Compound Name | (3aR,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;ethane |
|---|---|
| PubChem CID | 144768068 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (3aR,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;ethane |
| SMILES | CC.CC1CO[C@H]2OCC[C@H]12 |
| InChI | InChI=1S/C7H12O2.C2H6/c1-5-4-9-7-6(5)2-3-8-7;1-2/h5-7H,2-4H2,1H3;1-2H3/t5?,6-,7-;/m1./s1 |
| InChIKey | NNEOYWYZLPPBSP-IDRRLRINSA-N |
| XLogP | 2.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |