About 3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran
3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran (PubChem CID 12794840) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran.
Analyze 3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran?
The IUPAC name of 3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran (CID 12794840) is 3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran.
What is the SMILES notation for 3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran?
The canonical SMILES for 3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran is CC1COC2OCCCC12.
What is the InChIKey of 3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran?
The InChIKey is LBAYIVBFYVVULM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-6-5-10-8-7(6)3-2-4-9-8/h6-8H,2-5H2,1H3.
What are the key properties of 3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran?
3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran has a molecular weight of 142.20 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran is sourced from PubChem (CID 12794840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).