C11H24O2 — CID 144802403
(3aS,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;ethane (PubChem CID 144802403) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is (3aS,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;ethane.
| Compound Name | (3aS,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;ethane |
|---|---|
| PubChem CID | 144802403 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | (3aS,6aR)-4-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;ethane |
| SMILES | CC.CC.CC1CO[C@H]2OCC[C@@H]12 |
| InChI | InChI=1S/C7H12O2.2C2H6/c1-5-4-9-7-6(5)2-3-8-7;2*1-2/h5-7H,2-4H2,1H3;2*1-2H3/t5?,6-,7+;;/m0../s1 |
| InChIKey | AUIUPEIBHMZOBF-SXQRMIDESA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |