C8H16O3 — CID 142011906
(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol;ethane (PubChem CID 142011906) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol;ethane.
| Compound Name | (3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol;ethane |
|---|---|
| PubChem CID | 142011906 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol;ethane |
| SMILES | CC.OC1CO[C@H]2OCC[C@@H]12 |
| InChI | InChI=1S/C6H10O3.C2H6/c7-5-3-9-6-4(5)1-2-8-6;1-2/h4-7H,1-3H2;1-2H3/t4-,5?,6+;/m0./s1 |
| InChIKey | FOHVSLQXBRILJH-RREKBYKESA-N |
| XLogP | 0.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |