C15H28O7 — CID 157339017
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol;1-(2-propan-2-yloxyoxolan-3-yl)ethane-1,2-diol (PubChem CID 157339017) has the molecular formula C15H28O7 and a molecular weight of 320.38 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol;1-(2-propan-2-yloxyoxolan-3-yl)ethane-1,2-diol.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol;1-(2-propan-2-yloxyoxolan-3-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 157339017 |
| Molecular Formula | C15H28O7 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol;1-(2-propan-2-yloxyoxolan-3-yl)ethane-1,2-diol |
| SMILES | CC(C)OC1OCCC1C(O)CO.OC1COC2OCCC12 |
| InChI | InChI=1S/C9H18O4.C6H10O3/c1-6(2)13-9-7(3-4-12-9)8(11)5-10;7-5-3-9-6-4(5)1-2-8-6/h6-11H,3-5H2,1-2H3;4-7H,1-3H2 |
| InChIKey | BGEGUGGTHBATNF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |