About 2-propan-2-yloxyoxetane
2-propan-2-yloxyoxetane (PubChem CID 123446123) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is 2-propan-2-yloxyoxetane.
Molecular Properties
| Compound Name | 2-propan-2-yloxyoxetane |
| PubChem CID | 123446123 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 2-propan-2-yloxyoxetane |
| SMILES | CC(C)OC1CCO1 |
| InChI | InChI=1S/C6H12O2/c1-5(2)8-6-3-4-7-6/h5-6H,3-4H2,1-2H3 |
| InChIKey | JQDKEEUUBMNFNV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yloxyoxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxyoxetane?
The IUPAC name of 2-propan-2-yloxyoxetane (CID 123446123) is 2-propan-2-yloxyoxetane.
What is the SMILES notation for 2-propan-2-yloxyoxetane?
The canonical SMILES for 2-propan-2-yloxyoxetane is CC(C)OC1CCO1.
What is the InChIKey of 2-propan-2-yloxyoxetane?
The InChIKey is JQDKEEUUBMNFNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c1-5(2)8-6-3-4-7-6/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-propan-2-yloxyoxetane?
2-propan-2-yloxyoxetane has a molecular weight of 116.16 g/mol, XLogP of 1.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyoxetane is sourced from PubChem (CID 123446123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).