C9H14O3 — CID 138979764
(1S,4S,6R,7S,11S)-2,10-dioxatricyclo[5.3.1.04,11]undecan-6-ol (PubChem CID 138979764) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (1S,4S,6R,7S,11S)-2,10-dioxatricyclo[5.3.1.04,11]undecan-6-ol.
| Compound Name | (1S,4S,6R,7S,11S)-2,10-dioxatricyclo[5.3.1.04,11]undecan-6-ol |
|---|---|
| PubChem CID | 138979764 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (1S,4S,6R,7S,11S)-2,10-dioxatricyclo[5.3.1.04,11]undecan-6-ol |
| SMILES | O[C@@H]1C[C@@H]2CO[C@@H]3OCC[C@H]1[C@H]23 |
| InChI | InChI=1S/C9H14O3/c10-7-3-5-4-12-9-8(5)6(7)1-2-11-9/h5-10H,1-4H2/t5-,6-,7-,8+,9+/m1/s1 |
| InChIKey | VIKVKTCKXFNXCU-HXLXBVJFSA-N |
| XLogP | 0.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |