C9H14O3 — CID 130240779
(1R,2S,3S,6R,8S)-3-methyl-5,7,9-trioxatricyclo[6.3.0.02,6]undecane (PubChem CID 130240779) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (1R,2S,3S,6R,8S)-3-methyl-5,7,9-trioxatricyclo[6.3.0.02,6]undecane.
| Compound Name | (1R,2S,3S,6R,8S)-3-methyl-5,7,9-trioxatricyclo[6.3.0.02,6]undecane |
|---|---|
| PubChem CID | 130240779 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (1R,2S,3S,6R,8S)-3-methyl-5,7,9-trioxatricyclo[6.3.0.02,6]undecane |
| SMILES | C[C@@H]1CO[C@@H]2O[C@@H]3OCC[C@@H]3[C@@H]21 |
| InChI | InChI=1S/C9H14O3/c1-5-4-11-9-7(5)6-2-3-10-8(6)12-9/h5-9H,2-4H2,1H3/t5-,6-,7+,8+,9-/m1/s1 |
| InChIKey | LTLDRBBSFGWWKS-XGQMLPDNSA-N |
| XLogP | 0.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |