C8H13NO3 — CID 123749123
5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-amine (PubChem CID 123749123) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-amine.
| Compound Name | 5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-amine |
|---|---|
| PubChem CID | 123749123 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-amine |
| SMILES | NC1COC2OC3OCCC3C12 |
| InChI | InChI=1S/C8H13NO3/c9-5-3-11-8-6(5)4-1-2-10-7(4)12-8/h4-8H,1-3,9H2 |
| InChIKey | SGEKIOHKYUEMNM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |