C6H11NO3 — CID 123959878
O-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl)hydroxylamine (PubChem CID 123959878) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is O-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl)hydroxylamine.
| Compound Name | O-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl)hydroxylamine |
|---|---|
| PubChem CID | 123959878 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | O-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl)hydroxylamine |
| SMILES | NOC1COC2OCCC12 |
| InChI | InChI=1S/C6H11NO3/c7-10-5-3-9-6-4(5)1-2-8-6/h4-6H,1-3,7H2 |
| InChIKey | USYLRMJOCQVPEU-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|