C10H16O3 — CID 163910669
(3aS,4R,6aR)-4-cyclobutyloxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan (PubChem CID 163910669) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-cyclobutyloxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan.
| Compound Name | (3aS,4R,6aR)-4-cyclobutyloxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan |
|---|---|
| PubChem CID | 163910669 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (3aS,4R,6aR)-4-cyclobutyloxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan |
| SMILES | C1CC(O[C@H]2CO[C@H]3OCC[C@H]32)C1 |
| InChI | InChI=1S/C10H16O3/c1-2-7(3-1)13-9-6-12-10-8(9)4-5-11-10/h7-10H,1-6H2/t8-,9-,10+/m0/s1 |
| InChIKey | QRUIJXOHHOSLDU-LPEHRKFASA-N |
| XLogP | 1.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |