C10H14O4 — CID 139200718
(2R,6S,10R,14S)-5,7,9,11-tetraoxatetracyclo[6.6.0.02,6.010,14]tetradecane (PubChem CID 139200718) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (2R,6S,10R,14S)-5,7,9,11-tetraoxatetracyclo[6.6.0.02,6.010,14]tetradecane.
| Compound Name | (2R,6S,10R,14S)-5,7,9,11-tetraoxatetracyclo[6.6.0.02,6.010,14]tetradecane |
|---|---|
| PubChem CID | 139200718 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (2R,6S,10R,14S)-5,7,9,11-tetraoxatetracyclo[6.6.0.02,6.010,14]tetradecane |
| SMILES | C1C[C@@H]2C3C(O[C@@H]2O1)O[C@H]1OCC[C@@H]31 |
| InChI | InChI=1S/C10H14O4/c1-3-11-8-5(1)7-6-2-4-12-9(6)14-10(7)13-8/h5-10H,1-4H2/t5-,6+,7?,8+,9-,10? |
| InChIKey | LFGXDFQOUJBSOV-AIHUYORHSA-N |
| XLogP | 0.71 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |