C7H12O4 — CID 130240888
(4R,5R)-5-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol (PubChem CID 130240888) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is (4R,5R)-5-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol.
| Compound Name | (4R,5R)-5-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol |
|---|---|
| PubChem CID | 130240888 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (4R,5R)-5-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol |
| SMILES | CO[C@@H]1OC2OCCC2[C@H]1O |
| InChI | InChI=1S/C7H12O4/c1-9-7-5(8)4-2-3-10-6(4)11-7/h4-8H,2-3H2,1H3/t4?,5-,6?,7-/m1/s1 |
| InChIKey | DWRXQZQOYCPDEF-DHJFATIGSA-N |
| XLogP | -0.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |