About CID 59732107
CID 59732107 (PubChem CID 59732107) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol.
Molecular Properties
| Compound Name | CID 59732107 |
| PubChem CID | 59732107 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | — |
| SMILES | [CH]N[C@H]1CCOC1OC |
| InChI | InChI=1S/C6H11NO2/c1-7-5-3-4-9-6(5)8-2/h1,5-7H,3-4H2,2H3/t5-,6?/m0/s1 |
| InChIKey | DSJLFDNPXXWAHM-ZBHICJROSA-N |
| XLogP | 0.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze CID 59732107 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59732107?
The IUPAC name of CID 59732107 (CID 59732107) is not available.
What is the SMILES notation for CID 59732107?
The canonical SMILES for CID 59732107 is [CH]N[C@H]1CCOC1OC.
What is the InChIKey of CID 59732107?
The InChIKey is DSJLFDNPXXWAHM-ZBHICJROSA-N. The full InChI is InChI=1S/C6H11NO2/c1-7-5-3-4-9-6(5)8-2/h1,5-7H,3-4H2,2H3/t5-,6?/m0/s1.
What are the key properties of CID 59732107?
CID 59732107 has a molecular weight of 129.16 g/mol, XLogP of 0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59732107 is sourced from PubChem (CID 59732107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).