C10H18O3 — CID 71523916
(1S,4aS,6S,7R,7aS)-1-methoxy-7-methyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-6-ol (PubChem CID 71523916) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (1S,4aS,6S,7R,7aS)-1-methoxy-7-methyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-6-ol.
| Compound Name | (1S,4aS,6S,7R,7aS)-1-methoxy-7-methyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-6-ol |
|---|---|
| PubChem CID | 71523916 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (1S,4aS,6S,7R,7aS)-1-methoxy-7-methyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-6-ol |
| SMILES | CO[C@H]1OCC[C@H]2C[C@H](O)[C@H](C)[C@H]21 |
| InChI | InChI=1S/C10H18O3/c1-6-8(11)5-7-3-4-13-10(12-2)9(6)7/h6-11H,3-5H2,1-2H3/t6-,7-,8-,9+,10-/m0/s1 |
| InChIKey | PNSYSPPIOSIJCG-WLRJLXCNSA-N |
| XLogP | 1.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |