About 2-methoxyoxan-3-ol;propan-1-ol
2-methoxyoxan-3-ol;propan-1-ol (PubChem CID 145057675) has the molecular formula C9H20O4
and a molecular weight of 192.25 g/mol. Its IUPAC name is 2-methoxyoxan-3-ol;propan-1-ol.
Molecular Properties
| Compound Name | 2-methoxyoxan-3-ol;propan-1-ol |
| PubChem CID | 145057675 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2-methoxyoxan-3-ol;propan-1-ol |
| SMILES | CCCO.COC1OCCCC1O |
| InChI | InChI=1S/C6H12O3.C3H8O/c1-8-6-5(7)3-2-4-9-6;1-2-3-4/h5-7H,2-4H2,1H3;4H,2-3H2,1H3 |
| InChIKey | UYOODPDYRJUMOI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxyoxan-3-ol;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyoxan-3-ol;propan-1-ol?
The IUPAC name of 2-methoxyoxan-3-ol;propan-1-ol (CID 145057675) is 2-methoxyoxan-3-ol;propan-1-ol.
What is the SMILES notation for 2-methoxyoxan-3-ol;propan-1-ol?
The canonical SMILES for 2-methoxyoxan-3-ol;propan-1-ol is CCCO.COC1OCCCC1O.
What is the InChIKey of 2-methoxyoxan-3-ol;propan-1-ol?
The InChIKey is UYOODPDYRJUMOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C3H8O/c1-8-6-5(7)3-2-4-9-6;1-2-3-4/h5-7H,2-4H2,1H3;4H,2-3H2,1H3.
What are the key properties of 2-methoxyoxan-3-ol;propan-1-ol?
2-methoxyoxan-3-ol;propan-1-ol has a molecular weight of 192.25 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyoxan-3-ol;propan-1-ol is sourced from PubChem (CID 145057675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).