C11H22O3 — CID 10420393
4-[(2S,3R)-2-methoxyoxan-3-yl]-2-methylbutan-2-ol (PubChem CID 10420393) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 4-[(2S,3R)-2-methoxyoxan-3-yl]-2-methylbutan-2-ol.
| Compound Name | 4-[(2S,3R)-2-methoxyoxan-3-yl]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 10420393 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 4-[(2S,3R)-2-methoxyoxan-3-yl]-2-methylbutan-2-ol |
| SMILES | CO[C@H]1OCCC[C@@H]1CCC(C)(C)O |
| InChI | InChI=1S/C11H22O3/c1-11(2,12)7-6-9-5-4-8-14-10(9)13-3/h9-10,12H,4-8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | SOEIQKLRKKYRIM-ZJUUUORDSA-N |
| XLogP | 1.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |