About 3-iodo-2-methoxyoxepane
3-iodo-2-methoxyoxepane (PubChem CID 10923127) has the molecular formula C7H13IO2
and a molecular weight of 256.08 g/mol. Its IUPAC name is 3-iodo-2-methoxyoxepane.
Molecular Properties
| Compound Name | 3-iodo-2-methoxyoxepane |
| PubChem CID | 10923127 |
| Molecular Formula | C7H13IO2 |
| Molecular Weight | 256.08 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 3-iodo-2-methoxyoxepane |
| SMILES | COC1OCCCCC1I |
| InChI | InChI=1S/C7H13IO2/c1-9-7-6(8)4-2-3-5-10-7/h6-7H,2-5H2,1H3 |
| InChIKey | HJBCDGIBRQKQMR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.08 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2-methoxyoxepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2-methoxyoxepane?
The IUPAC name of 3-iodo-2-methoxyoxepane (CID 10923127) is 3-iodo-2-methoxyoxepane.
What is the SMILES notation for 3-iodo-2-methoxyoxepane?
The canonical SMILES for 3-iodo-2-methoxyoxepane is COC1OCCCCC1I.
What is the InChIKey of 3-iodo-2-methoxyoxepane?
The InChIKey is HJBCDGIBRQKQMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13IO2/c1-9-7-6(8)4-2-3-5-10-7/h6-7H,2-5H2,1H3.
What are the key properties of 3-iodo-2-methoxyoxepane?
3-iodo-2-methoxyoxepane has a molecular weight of 256.08 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2-methoxyoxepane is sourced from PubChem (CID 10923127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).