About 2-(dimethoxymethyl)oxane
2-(dimethoxymethyl)oxane (PubChem CID 101048405) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 2-(dimethoxymethyl)oxane.
Molecular Properties
| Compound Name | 2-(dimethoxymethyl)oxane |
| PubChem CID | 101048405 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 2-(dimethoxymethyl)oxane |
| SMILES | COC(OC)C1CCCCO1 |
| InChI | InChI=1S/C8H16O3/c1-9-8(10-2)7-5-3-4-6-11-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | MICKJZVYOXBGBC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethoxymethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethoxymethyl)oxane?
The IUPAC name of 2-(dimethoxymethyl)oxane (CID 101048405) is 2-(dimethoxymethyl)oxane.
What is the SMILES notation for 2-(dimethoxymethyl)oxane?
The canonical SMILES for 2-(dimethoxymethyl)oxane is COC(OC)C1CCCCO1.
What is the InChIKey of 2-(dimethoxymethyl)oxane?
The InChIKey is MICKJZVYOXBGBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-9-8(10-2)7-5-3-4-6-11-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-(dimethoxymethyl)oxane?
2-(dimethoxymethyl)oxane has a molecular weight of 160.21 g/mol, XLogP of 1.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethoxymethyl)oxane is sourced from PubChem (CID 101048405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).