About 2-(1-fluoropropyl)oxane
2-(1-fluoropropyl)oxane (PubChem CID 67686037) has the molecular formula C8H15FO
and a molecular weight of 146.20 g/mol. Its IUPAC name is 2-(1-fluoropropyl)oxane.
Molecular Properties
| Compound Name | 2-(1-fluoropropyl)oxane |
| PubChem CID | 67686037 |
| Molecular Formula | C8H15FO |
| Molecular Weight | 146.20 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 2-(1-fluoropropyl)oxane |
| SMILES | CCC(F)C1CCCCO1 |
| InChI | InChI=1S/C8H15FO/c1-2-7(9)8-5-3-4-6-10-8/h7-8H,2-6H2,1H3 |
| InChIKey | CSQSOJZQURRGFV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1-fluoropropyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-fluoropropyl)oxane?
The IUPAC name of 2-(1-fluoropropyl)oxane (CID 67686037) is 2-(1-fluoropropyl)oxane.
What is the SMILES notation for 2-(1-fluoropropyl)oxane?
The canonical SMILES for 2-(1-fluoropropyl)oxane is CCC(F)C1CCCCO1.
What is the InChIKey of 2-(1-fluoropropyl)oxane?
The InChIKey is CSQSOJZQURRGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FO/c1-2-7(9)8-5-3-4-6-10-8/h7-8H,2-6H2,1H3.
What are the key properties of 2-(1-fluoropropyl)oxane?
2-(1-fluoropropyl)oxane has a molecular weight of 146.20 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-fluoropropyl)oxane is sourced from PubChem (CID 67686037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).