About 2-methoxy-3-nitrooxane
2-methoxy-3-nitrooxane (PubChem CID 175828059) has the molecular formula C6H11NO4
and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-methoxy-3-nitrooxane.
Molecular Properties
| Compound Name | 2-methoxy-3-nitrooxane |
| PubChem CID | 175828059 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 2-methoxy-3-nitrooxane |
| SMILES | COC1OCCCC1[N+](=O)[O-] |
| InChI | InChI=1S/C6H11NO4/c1-10-6-5(7(8)9)3-2-4-11-6/h5-6H,2-4H2,1H3 |
| InChIKey | CDYCRFFDDQAILR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-3-nitrooxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-nitrooxane?
The IUPAC name of 2-methoxy-3-nitrooxane (CID 175828059) is 2-methoxy-3-nitrooxane.
What is the SMILES notation for 2-methoxy-3-nitrooxane?
The canonical SMILES for 2-methoxy-3-nitrooxane is COC1OCCCC1[N+](=O)[O-].
What is the InChIKey of 2-methoxy-3-nitrooxane?
The InChIKey is CDYCRFFDDQAILR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4/c1-10-6-5(7(8)9)3-2-4-11-6/h5-6H,2-4H2,1H3.
What are the key properties of 2-methoxy-3-nitrooxane?
2-methoxy-3-nitrooxane has a molecular weight of 161.16 g/mol, XLogP of 0.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-nitrooxane is sourced from PubChem (CID 175828059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).