About 2-chloro-1,3-dinitrocyclohexane
2-chloro-1,3-dinitrocyclohexane (PubChem CID 154109386) has the molecular formula C6H9ClN2O4
and a molecular weight of 208.60 g/mol. Its IUPAC name is 2-chloro-1,3-dinitrocyclohexane.
Molecular Properties
| Compound Name | 2-chloro-1,3-dinitrocyclohexane |
| PubChem CID | 154109386 |
| Molecular Formula | C6H9ClN2O4 |
| Molecular Weight | 208.60 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 2-chloro-1,3-dinitrocyclohexane |
| SMILES | O=[N+]([O-])C1CCCC([N+](=O)[O-])C1Cl |
| InChI | InChI=1S/C6H9ClN2O4/c7-6-4(8(10)11)2-1-3-5(6)9(12)13/h4-6H,1-3H2 |
| InChIKey | BAYQZQQXKTVLJP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.60 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3-dinitrocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-dinitrocyclohexane?
The IUPAC name of 2-chloro-1,3-dinitrocyclohexane (CID 154109386) is 2-chloro-1,3-dinitrocyclohexane.
What is the SMILES notation for 2-chloro-1,3-dinitrocyclohexane?
The canonical SMILES for 2-chloro-1,3-dinitrocyclohexane is O=[N+]([O-])C1CCCC([N+](=O)[O-])C1Cl.
What is the InChIKey of 2-chloro-1,3-dinitrocyclohexane?
The InChIKey is BAYQZQQXKTVLJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2O4/c7-6-4(8(10)11)2-1-3-5(6)9(12)13/h4-6H,1-3H2.
What are the key properties of 2-chloro-1,3-dinitrocyclohexane?
2-chloro-1,3-dinitrocyclohexane has a molecular weight of 208.60 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-dinitrocyclohexane is sourced from PubChem (CID 154109386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).