About methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate
methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate (PubChem CID 11672968) has the molecular formula C9H15NO5
and a molecular weight of 217.22 g/mol. Its IUPAC name is methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate.
Molecular Properties
| Compound Name | methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate |
| PubChem CID | 11672968 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate |
| SMILES | COC(=O)[C@@H](O)[C@@H]1CCCC[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C9H15NO5/c1-15-9(12)8(11)6-4-2-3-5-7(6)10(13)14/h6-8,11H,2-5H2,1H3/t6-,7+,8+/m1/s1 |
| InChIKey | BRWCAHWHQVOCQU-CSMHCCOUSA-N |
| XLogP | 0.36 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate?
The IUPAC name of methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate (CID 11672968) is methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate.
What is the SMILES notation for methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate?
The canonical SMILES for methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate is COC(=O)[C@@H](O)[C@@H]1CCCC[C@@H]1[N+](=O)[O-].
What is the InChIKey of methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate?
The InChIKey is BRWCAHWHQVOCQU-CSMHCCOUSA-N. The full InChI is InChI=1S/C9H15NO5/c1-15-9(12)8(11)6-4-2-3-5-7(6)10(13)14/h6-8,11H,2-5H2,1H3/t6-,7+,8+/m1/s1.
What are the key properties of methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate?
methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate has a molecular weight of 217.22 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-hydroxy-2-[(1R,2S)-2-nitrocyclohexyl]acetate is sourced from PubChem (CID 11672968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).