C15H19NO4 — CID 135017267
ethyl (2R)-2-[(1S,2R)-2-nitrocyclopentyl]-2-phenylacetate (PubChem CID 135017267) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is ethyl (2R)-2-[(1S,2R)-2-nitrocyclopentyl]-2-phenylacetate.
| Compound Name | ethyl (2R)-2-[(1S,2R)-2-nitrocyclopentyl]-2-phenylacetate |
|---|---|
| PubChem CID | 135017267 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | ethyl (2R)-2-[(1S,2R)-2-nitrocyclopentyl]-2-phenylacetate |
| SMILES | CCOC(=O)[C@@H](c1ccccc1)[C@@H]1CCC[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19NO4/c1-2-20-15(17)14(11-7-4-3-5-8-11)12-9-6-10-13(12)16(18)19/h3-5,7-8,12-14H,2,6,9-10H2,1H3/t12-,13-,14+/m1/s1 |
| InChIKey | PBJRQZXEQBMQLK-MCIONIFRSA-N |
| XLogP | 2.78 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|