C5H7NO4 — CID 39870404
trans-methyl (1R,2R)-2-nitrocyclopropane-1-carboxylate (PubChem CID 39870404) has the molecular formula C5H7NO4 and a molecular weight of 145.11 g/mol. Its IUPAC name is trans-methyl (1R,2R)-2-nitrocyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1R,2R)-2-nitrocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 39870404 |
| Molecular Formula | C5H7NO4 |
| Molecular Weight | 145.11 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | trans-methyl (1R,2R)-2-nitrocyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C5H7NO4/c1-10-5(7)3-2-4(3)6(8)9/h3-4H,2H2,1H3/t3-,4-/m1/s1 |
| InChIKey | IUWIUHGJPLTNRP-QWWZWVQMSA-N |
| XLogP | -0.18 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.11 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|