C9H13NO6 — CID 11356689
methyl (1S,2R,3S)-3-methoxy-2-nitro-5-oxocyclohexane-1-carboxylate (PubChem CID 11356689) has the molecular formula C9H13NO6 and a molecular weight of 231.20 g/mol. Its IUPAC name is methyl (1S,2R,3S)-3-methoxy-2-nitro-5-oxocyclohexane-1-carboxylate.
| Compound Name | methyl (1S,2R,3S)-3-methoxy-2-nitro-5-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11356689 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | methyl (1S,2R,3S)-3-methoxy-2-nitro-5-oxocyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC(=O)C[C@H](OC)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13NO6/c1-15-7-4-5(11)3-6(9(12)16-2)8(7)10(13)14/h6-8H,3-4H2,1-2H3/t6-,7-,8+/m0/s1 |
| InChIKey | LRWISKFEMGFADZ-BIIVOSGPSA-N |
| XLogP | -0.20 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|