C20H28N2O5 — CID 77484275
methyl 2-[2-(2-nitrocyclohexyl)butanoylamino]-3-phenylpropanoate (PubChem CID 77484275) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is methyl 2-[2-(2-nitrocyclohexyl)butanoylamino]-3-phenylpropanoate.
| Compound Name | methyl 2-[2-(2-nitrocyclohexyl)butanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 77484275 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | methyl 2-[2-(2-nitrocyclohexyl)butanoylamino]-3-phenylpropanoate |
| SMILES | CCC(C(=O)NC(Cc1ccccc1)C(=O)OC)C1CCCCC1[N+](=O)[O-] |
| InChI | InChI=1S/C20H28N2O5/c1-3-15(16-11-7-8-12-18(16)22(25)26)19(23)21-17(20(24)27-2)13-14-9-5-4-6-10-14/h4-6,9-10,15-18H,3,7-8,11-13H2,1-2H3,(H,21,23) |
| InChIKey | BXDLEGZSWNVJFM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|