C21H23NO4 — CID 135017103
benzyl (2S)-2-[(1S,2R)-2-nitrocyclopentyl]-3-phenylpropanoate (PubChem CID 135017103) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is benzyl (2S)-2-[(1S,2R)-2-nitrocyclopentyl]-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[(1S,2R)-2-nitrocyclopentyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 135017103 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | benzyl (2S)-2-[(1S,2R)-2-nitrocyclopentyl]-3-phenylpropanoate |
| SMILES | O=C(OCc1ccccc1)[C@@H](Cc1ccccc1)[C@@H]1CCC[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23NO4/c23-21(26-15-17-10-5-2-6-11-17)19(14-16-8-3-1-4-9-16)18-12-7-13-20(18)22(24)25/h1-6,8-11,18-20H,7,12-15H2/t18-,19-,20+/m0/s1 |
| InChIKey | SNCVWBFEKZBPBV-SLFFLAALSA-N |
| XLogP | 4.03 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|