C12H19NO4 — CID 102064613
3-ethoxy-1-[(1R,2R)-2-nitrocyclohexyl]but-3-en-2-one (PubChem CID 102064613) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-ethoxy-1-[(1R,2R)-2-nitrocyclohexyl]but-3-en-2-one.
| Compound Name | 3-ethoxy-1-[(1R,2R)-2-nitrocyclohexyl]but-3-en-2-one |
|---|---|
| PubChem CID | 102064613 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-ethoxy-1-[(1R,2R)-2-nitrocyclohexyl]but-3-en-2-one |
| SMILES | C=C(OCC)C(=O)C[C@H]1CCCC[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19NO4/c1-3-17-9(2)12(14)8-10-6-4-5-7-11(10)13(15)16/h10-11H,2-8H2,1H3/t10-,11-/m1/s1 |
| InChIKey | AULYCNRXXPUETL-GHMZBOCLSA-N |
| XLogP | 2.33 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|