C16H26N2O4 — CID 10519018
4-[(1E)-3-ethoxy-1-[(1S,2R)-2-nitrocyclohexyl]buta-1,3-dien-2-yl]morpholine (PubChem CID 10519018) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 4-[(1E)-3-ethoxy-1-[(1S,2R)-2-nitrocyclohexyl]buta-1,3-dien-2-yl]morpholine.
| Compound Name | 4-[(1E)-3-ethoxy-1-[(1S,2R)-2-nitrocyclohexyl]buta-1,3-dien-2-yl]morpholine |
|---|---|
| PubChem CID | 10519018 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 4-[(1E)-3-ethoxy-1-[(1S,2R)-2-nitrocyclohexyl]buta-1,3-dien-2-yl]morpholine |
| SMILES | C=C(OCC)/C(=C\[C@@H]1CCCC[C@H]1[N+](=O)[O-])N1CCOCC1 |
| InChI | InChI=1S/C16H26N2O4/c1-3-22-13(2)16(17-8-10-21-11-9-17)12-14-6-4-5-7-15(14)18(19)20/h12,14-15H,2-11H2,1H3/b16-12+/t14-,15+/m0/s1 |
| InChIKey | ITNLWKXKEWWNSJ-SXVLCJDNSA-N |
| XLogP | 2.59 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|