C13H21NO — CID 134380103
2-ethenyl-1-(3-ethoxybuta-1,3-dien-2-yl)piperidine (PubChem CID 134380103) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-ethenyl-1-(3-ethoxybuta-1,3-dien-2-yl)piperidine.
| Compound Name | 2-ethenyl-1-(3-ethoxybuta-1,3-dien-2-yl)piperidine |
|---|---|
| PubChem CID | 134380103 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2-ethenyl-1-(3-ethoxybuta-1,3-dien-2-yl)piperidine |
| SMILES | C=CC1CCCCN1C(=C)C(=C)OCC |
| InChI | InChI=1S/C13H21NO/c1-5-13-9-7-8-10-14(13)11(3)12(4)15-6-2/h5,13H,1,3-4,6-10H2,2H3 |
| InChIKey | CRPUUMFLKJRFTF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|