C11H15F2NO — CID 129349370
[(1S)-2,2-difluorocyclopropyl]-[(2S)-2-ethenylpiperidin-1-yl]methanone (PubChem CID 129349370) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is [(1S)-2,2-difluorocyclopropyl]-[(2S)-2-ethenylpiperidin-1-yl]methanone.
| Compound Name | [(1S)-2,2-difluorocyclopropyl]-[(2S)-2-ethenylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 129349370 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | [(1S)-2,2-difluorocyclopropyl]-[(2S)-2-ethenylpiperidin-1-yl]methanone |
| SMILES | C=C[C@@H]1CCCCN1C(=O)[C@@H]1CC1(F)F |
| InChI | InChI=1S/C11H15F2NO/c1-2-8-5-3-4-6-14(8)10(15)9-7-11(9,12)13/h2,8-9H,1,3-7H2/t8-,9+/m1/s1 |
| InChIKey | QERAOWDSTVCIRE-BDAKNGLRSA-N |
| XLogP | 2.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|