C9H16O — CID 100959925
(4aR,5S,7aS)-5-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran (PubChem CID 100959925) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (4aR,5S,7aS)-5-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran.
| Compound Name | (4aR,5S,7aS)-5-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran |
|---|---|
| PubChem CID | 100959925 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (4aR,5S,7aS)-5-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran |
| SMILES | C[C@H]1CC[C@@H]2OCCC[C@@H]21 |
| InChI | InChI=1S/C9H16O/c1-7-4-5-9-8(7)3-2-6-10-9/h7-9H,2-6H2,1H3/t7-,8+,9-/m0/s1 |
| InChIKey | UHUSQLBKIRUTII-YIZRAAEISA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |