C7H13NO — CID 97308025
(1S,6S,7S)-2-oxabicyclo[4.2.0]octan-7-amine (PubChem CID 97308025) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is (1S,6S,7S)-2-oxabicyclo[4.2.0]octan-7-amine.
| Compound Name | (1S,6S,7S)-2-oxabicyclo[4.2.0]octan-7-amine |
|---|---|
| PubChem CID | 97308025 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (1S,6S,7S)-2-oxabicyclo[4.2.0]octan-7-amine |
| SMILES | N[C@H]1C[C@@H]2OCCC[C@H]21 |
| InChI | InChI=1S/C7H13NO/c8-6-4-7-5(6)2-1-3-9-7/h5-7H,1-4,8H2/t5-,6-,7-/m0/s1 |
| InChIKey | VYQRMUFYXHFYSF-ACZMJKKPSA-N |
| XLogP | 0.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |