C8H15NO — CID 82418057
2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-amine (PubChem CID 82418057) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-amine.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-amine |
|---|---|
| PubChem CID | 82418057 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-amine |
| SMILES | NC1CCOC2CCCC12 |
| InChI | InChI=1S/C8H15NO/c9-7-4-5-10-8-3-1-2-6(7)8/h6-8H,1-5,9H2 |
| InChIKey | DCOUQQUCBJRWMZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |